CAS 222036-17-1

4-{[(Z)-(7-oxo-6,7-dihydro-8H-[1,3]thiazolo[5,4-e]indol-8-ylidene)methyl]amino}-N-pyridin-2-ylbenzenesulfonamide

Description:

The chemical substance known as 4-{[(Z)-(7-oxo-6,7-dihydro-8H-[1,3]thiazolo[5,4-e]indol-8-ylidene)methyl]amino}-N-pyridin-2-ylbenzenesulfonamide, with the CAS number 222036-17-1, is characterized by its complex molecular structure, which includes a thiazoloindole core and a sulfonamide functional group. This compound exhibits potential biological activity, often investigated for its role in medicinal chemistry, particularly in the context of targeting specific enzymes or receptors. The presence of the pyridine ring contributes to its lipophilicity and may enhance its interaction with biological targets. Additionally, the Z configuration of the double bond in the molecule suggests specific stereochemical properties that can influence its biological activity and pharmacokinetics. The sulfonamide group is known for its ability to form hydrogen bonds, which can be crucial for binding interactions in biological systems. Overall, this compound represents a class of heterocyclic compounds that may have applications in drug development and therapeutic interventions.

Formula: C₂₁H₁₅N₅O₃S₂

InChI: InChI=1/C21H15N5O3S2/c27-21-15(19-16(25-21)8-9-17-20(19)30-12-24-17)11-23-13-4-6-14(7-5-13)31(28,29)26-18-3-1-2-10-22-18/h1-12,23H,(H,22,26)(H,25,27)/b15-11-

SMILES: c1ccnc(c1)NS(=O)(=O)c1ccc(cc1)N/C=C\1/c2c(ccc3c2scn3)N=C1O

GW8510

CAS: 222036-17-1

Formula: C₂₁H₁₅N₅O₃S₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 449.5055

Ref: IN-DA007P7Z

4-(((7-Oxo-6,7-dihydro-8H-thiazolo[5,4-e]indol-8-ylidene)methyl)amino)-N-(pyridin-2-yl)benzenesulfonamide

CAS: 222036-17-1

4-(((7-Oxo-6,7-dihydro-8H-thiazolo[5,4-e]indol-8-ylidene)methyl)amino)-N-(pyridin-2-yl)benzenesulfonamide

Purity: 98%

Molecular weight: 449.52g/mol

Ref: 54-OR1062975

GW8510

CAS: 222036-17-1

Formula: C₂₁H₁₅N₅O₃S₂

Molecular weight: 449.51

Ref: 7W-GL1631

GW8510

CAS: 222036-17-1

GW8510 is a CDK2 and RRM2 inhibitor that affects DNA synthesis and antiproliferation in tumor cells. In mammalian aging models, GW851 prolongs lifespan.

Formula: C₂₁H₁₅N₅O₃S₂

Purity: 99.32%

Color and Shape: Solid

Molecular weight: 449.51

Ref: TM-T24125