CAS 2221-13-8
:N-phenyl-2,5-imidazolinedione
Description:
N-phenyl-2,5-imidazolinedione, also known as phthalimide, is an organic compound characterized by its imide functional group, which consists of a five-membered ring containing two nitrogen atoms and a carbonyl group. This compound typically appears as a white crystalline solid and is known for its stability and low solubility in water, but it is soluble in organic solvents such as ethanol and acetone. N-phenyl-2,5-imidazolinedione exhibits a range of chemical properties, including the ability to undergo nucleophilic substitution reactions, making it useful in various synthetic applications. It is often employed in the synthesis of pharmaceuticals, agrochemicals, and dyes. Additionally, its derivatives can exhibit biological activity, which has led to research into its potential therapeutic uses. Safety data indicates that, while generally considered low in toxicity, appropriate handling and safety measures should be observed due to potential irritant properties. Overall, N-phenyl-2,5-imidazolinedione is a versatile compound with significant relevance in organic chemistry and industrial applications.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c12-8-6-10-9(13)11(8)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)
SMILES:c1ccc(cc1)N1C(=O)CN=C1O
Synonyms:- 2,4-Imidazolidinedione, 3-phenyl-
- 3-Phenylimidazolidine-2,4-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Phenylhydantoin, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H8N2O2Purity:95%Molecular weight:176.173-Phenylimidazolidine-2,4-dione
CAS:Formula:C9H8N2O2Purity:95%Color and Shape:SolidMolecular weight:176.17203-Phenylimidazolidine-2,4-dione
CAS:3-Phenylimidazolidine-2,4-dionePurity:95%Molecular weight:176.17g/mol3-Phenyl-imidazolidine-2,4-dione
CAS:Formula:C9H8N2O2Purity:95%Color and Shape:SolidMolecular weight:176.1753-Phenyl-imidazolidine-2,4-dione
CAS:3-Phenyl-imidazolidine-2,4-dione is an organic compound that is a white solid. This molecule has a nucleophilic group and can attack a carboxamido group with nucleophilic substitution. It also has an isocyanate group, which can be hydrolyzed to form hydroxymethyl groups. 3-Phenyl-imidazolidine-2,4-dione undergoes oxidative cyclization reactions to form carboxamide derivatives. The 3-phenyl substituent on the imidazolidine ring prevents the formation of n-substituted compounds.Formula:C9H8N2O2Purity:Min. 95%Molecular weight:176.18 g/mol




