CAS 2221-13-8: N-phenyl-2,5-imidazolinedione

Description:N-phenyl-2,5-imidazolinedione, also known as phthalimide, is an organic compound characterized by its imide functional group, which consists of a five-membered ring containing two nitrogen atoms and a carbonyl group. This compound typically appears as a white crystalline solid and is known for its stability and low solubility in water, but it is soluble in organic solvents such as ethanol and acetone. N-phenyl-2,5-imidazolinedione exhibits a range of chemical properties, including the ability to undergo nucleophilic substitution reactions, making it useful in various synthetic applications. It is often employed in the synthesis of pharmaceuticals, agrochemicals, and dyes. Additionally, its derivatives can exhibit biological activity, which has led to research into its potential therapeutic uses. Safety data indicates that, while generally considered low in toxicity, appropriate handling and safety measures should be observed due to potential irritant properties. Overall, N-phenyl-2,5-imidazolinedione is a versatile compound with significant relevance in organic chemistry and industrial applications.

Formula:C₉H₈N₂O₂

InChI:InChI=1/C9H8N2O2/c12-8-6-10-9(13)11(8)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)

Synonyms:
2,4-Imidazolidinedione, 3-phenyl-
3-Phenylimidazolidine-2,4-dione

Found 5 products.

Product data	Purity	Price range	Estimated delivery
3-Phenylhydantoin, 95% REF: 02-H63009CAS: 2221-13-8	95%	To inquire	Tue 01 Apr 25
3-PHENYLIMIDAZOLIDINE-2,4-DIONE REF: IN-DA00BC9NCAS: 2221-13-8	95%	66.00 €~484.00 €	Mon 07 Apr 25
3-Phenylimidazolidine-2,4-dione REF: 54-OR937596CAS: 2221-13-8	95%	113.00 €~182.00 €	Mon 14 Apr 25
3-Phenyl-imidazolidine-2,4-dione REF: 10-F043361CAS: 2221-13-8	95.0%	To inquire	Tue 15 Apr 25
3-Phenyl-imidazolidine-2,4-dione REF: 3D-CAA22113CAS: 2221-13-8	Min. 95%	To inquire	Mon 19 May 25