CAS 222180-20-3
:4′-Formyl[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-Formyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features both an aldehyde group (-CHO) and a carboxylic acid group (-COOH), contributing to its reactivity and potential applications in organic synthesis. The presence of these functional groups allows for various chemical transformations, making it useful in the synthesis of more complex molecules. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in materials science. Additionally, the compound may display interesting optical properties due to the conjugated system formed by the biphenyl structure, which can be explored in dye or sensor applications. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C14H10O3
InChI:InChI=1S/C14H10O3/c15-9-10-4-6-11(7-5-10)12-2-1-3-13(8-12)14(16)17/h1-9H,(H,16,17)
InChI key:InChIKey=PLPKINAPTMTZJU-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1)C2=CC=C(C=O)C=C2
Synonyms:- 4'-Formyl-1,1'-Biphenyl-3-Carboxylic Acid
- [1,1'-Biphenyl]-3-carboxylic acid, 4'-formyl-
- 4′-Formylbiphenyl-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4'-Formyl-[1,1'-biphenyl]-3-carboxylic acid
CAS:Formula:C14H10O3Purity:98%Color and Shape:SolidMolecular weight:226.22744'-Formyl[1,1'-biphenyl]-3-carboxylic acid
CAS:4'-Formyl[1,1'-biphenyl]-3-carboxylic acidFormula:C14H10O3Purity:≥95%Color and Shape: off white crystalline solidMolecular weight:226.23g/mol4′-Formyl-biphenyl-3-carboxylic acid
CAS:Formula:C14H10O3Purity:98%Color and Shape:SolidMolecular weight:226.2313-(4-Formylphenyl)benzoic acid
CAS:3-(4-Formylphenyl)benzoic acid (4FPBA) is a natural compound found in plants, such as the leaves of Eucalyptus globulus. 4FPBA has been shown to have antioxidant activity in vitro and can protect against hydrogen peroxide-induced lipid peroxidation. It also inhibits the growth of gram-negative bacteria, such as Escherichia coli and Salmonella enterica. In addition, 4FPBA may be used to treat candida albicans infections and Aspergillus fumigatus infections. The biological studies of 4FPBA show that it has antibacterial properties and can inhibit cell growth.Formula:C14H10O3Purity:Min. 95%Molecular weight:226.23 g/mol



