CAS 222191-28-8

3-Methyl-4-pyridinecarboxaldehyde oxime

Description:

3-Methyl-4-pyridinecarboxaldehyde oxime, with the CAS number 222191-28-8, is an organic compound characterized by its oxime functional group attached to a pyridine ring. This compound features a methyl group at the 3-position and an aldehyde group at the 4-position of the pyridine ring, which contributes to its reactivity and potential applications in organic synthesis. The presence of the oxime group indicates that it can participate in various chemical reactions, such as condensation and rearrangement, making it useful in the synthesis of more complex molecules. Typically, compounds like this exhibit moderate polarity due to the electronegative nitrogen and oxygen atoms, which can influence their solubility in polar solvents. Additionally, 3-Methyl-4-pyridinecarboxaldehyde oxime may display biological activity, which could be of interest in pharmaceutical research. Its structural features suggest potential applications in agrochemicals, dyes, or as intermediates in the synthesis of other organic compounds. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₇H₈N₂O

InChI: InChI=1S/C7H8N2O/c1-6-4-8-3-2-7(6)5-9-10/h2-5,10H,1H3

InChI key: InChIKey=CEKADNHWYWFTSV-UHFFFAOYSA-N

SMILES: C(=NO)C=1C(C)=CN=CC1

Synonyms:

• 4-Pyridinecarboxaldehyde, 3-methyl-, oxime
• 3-Methyl-4-pyridinecarboxaldehyde oxime

N-[(3-Methylpyridin-4-yl)methylidene]hydroxylamine

CAS: 222191-28-8

Versatile small molecule scaffold

Formula: C₇H₈N₂O

Purity: Min. 95%

Molecular weight: 136.15 g/mol

Ref: 3D-XIA19128