CAS 2221948-96-3

4,7,10,13,16,19,22,25,28,31,34,37,40,43,46,49,52,55,58,61,64,67,70,73,76-Pentacosaoxanonaheptacontanedioic acid, 1,79-bis(2,5-dioxo-1-pyrrolidinyl) ester

Description:

The chemical substance known as "4,7,10,13,16,19,22,25,28,31,34,37,40,43,46,49,52,55,58,61,64,67,70,73,76-Pentacosaoxanonaheptacontanedioic acid, 1,79-bis(2,5-dioxo-1-pyrrolidinyl) ester" with CAS number 2221948-96-3 is a complex organic compound characterized by a long carbon chain and multiple functional groups. It features a pentacosaoxanonaheptacontanedioic acid backbone, indicating a significant degree of molecular complexity, including numerous ether and ester linkages. The presence of pyrrolidinyl groups suggests potential reactivity and biological activity, as these structures are often associated with various pharmacological properties. This compound may exhibit properties such as solubility in organic solvents, potential for forming hydrogen bonds, and the ability to participate in various chemical reactions due to its functional groups. Its large molecular size and specific structural features may also influence its physical properties, such as melting point, boiling point, and viscosity. Overall, this compound's unique characteristics make it of interest in fields such as materials science, medicinal chemistry, and polymer chemistry.

Formula: C₆₂H₁₁₂N₂O₃₃

InChI: InChI=1S/C62H112N2O33/c65-57-1-2-58(66)63(57)96-61(69)5-7-71-9-11-73-13-15-75-17-19-77-21-23-79-25-27-81-29-31-83-33-35-85-37-39-87-41-43-89-45-47-91-49-51-93-53-55-95-56-54-94-52-50-92-48-46-90-44-42-88-40-38-86-36-34-84-32-30-82-28-26-80-24-22-78-20-18-76-16-14-74-12-10-72-8-6-62(70)97-64-59(67)3-4-60(64)68/h1-56H2

InChI key: InChIKey=JPTYKIPGEDAOCK-UHFFFAOYSA-N

SMILES: O(C(CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(ON1C(=O)CCC1=O)=O)=O)N2C(=O)CCC2=O

Synonyms:

• 4,7,10,13,16,19,22,25,28,31,34,37,40,43,46,49,52,55,58,61,64,67,70,73,76-Pentacosaoxanonaheptacontanedioic acid, 1,79-bis(2,5-dioxo-1-pyrrolidinyl) ester

4,7,10,13,16,19,22,25,28,31,34,37,40,43,46,49,52,55,58,61,64,67,70,73,76-Pentacosaoxanonaheptacontanedioic acid, 1,79-bis(2,5-dioxo-1-pyrrolidinyl) ester

CAS: 2221948-96-3

Formula: C₆₂H₁₁₂N₂O₃₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 1413.5463

Ref: IN-DA01K5FI

Bis-PEG25-NHS ester

CAS: 2221948-96-3

Bis-PEG25-NHS ester is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1].

Formula: C₆₂H₁₁₂N₂O₃₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 1413.55

Ref: TM-T17627

Bis-PEG25-NHS ester

CAS: 2221948-96-3

Purity: 98%

Molecular weight: 400.11

Ref: 10-F554695

Bis-PEG25-NHS ester

CAS: 2221948-96-3

Bis-PEG25-NHS ester is a PEG polymer categorised as homobifunctional PEG (X-PEG X). Used as a linker, bis-PEG25-NHS ester is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Formula: C₆₂H₁₁₂N₂O₃₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 1,413.5 g/mol

Ref: 3D-WND94896