CAS 22224-41-5: α-D-Ribofuranose, 1,3,5-tribenzoate
Description:α-D-Ribofuranose, 1,3,5-tribenzoate is a chemical compound derived from ribofuranose, a sugar that plays a crucial role in various biological processes, particularly in nucleic acid metabolism. This compound features a ribofuranose backbone with three benzoate groups esterified at the 1, 3, and 5 positions, which significantly influences its solubility and reactivity. The presence of these benzoate groups enhances the compound's hydrophobic characteristics, making it less soluble in water compared to its parent sugar. The molecular structure contributes to its potential applications in biochemistry and pharmaceuticals, particularly in drug design and delivery systems. Additionally, the compound may exhibit interesting properties such as UV absorbance due to the aromatic nature of the benzoate moieties. Its CAS number, 22224-41-5, allows for easy identification in chemical databases, facilitating research and development in various scientific fields. Overall, α-D-Ribofuranose, 1,3,5-tribenzoate is a significant compound with unique characteristics that warrant further exploration in both academic and industrial contexts.
Formula:C26H22O8
InChI:InChI=1S/C26H22O8/c27-21-22(33-24(29)18-12-6-2-7-13-18)20(16-31-23(28)17-10-4-1-5-11-17)32-26(21)34-25(30)19-14-8-3-9-15-19/h1-15,20-22,26-27H,16H2/t20-,21-,22-,26-/m1/s1
InChI key:InChIKey=HUHVPBKTTFVAQF-PIXQIBFHSA-N
SMILES:O=C(OCC1OC(OC(=O)C=2C=CC=CC2)C(O)C1OC(=O)C=3C=CC=CC3)C=4C=CC=CC4
- Synonyms:
- 1,3,5-Tri-O-Benzoyl-D-Ribofuranose
- 1,3,5-Tri-O-benzoyl-alpha-D-ribofuranoside
- 1,3,5-Tri-O-benzoyl-α-<span class="text-smallcaps">D</span>-ribofuranose
- 1,3,5-Tri-O-benzoyl-α-D-ribofuranoside
- 1,3,5-tri-O-benzoyl-α-D-ribofuranose
- 1,3,5-tris-O-(phenylcarbonyl)-alpha-D-ribofuranose
- Clofarabine intermediate (III)
- Ribofuranose, 1,3,5-tribenzoate
- alpha-D-Ribofuranose 1,3,5-tribenzoate
- α-<span class="text-smallcaps">D</span>-1,3,5-Tri-O-benzoyl-ribofuranose
- See more synonyms
- α-<span class="text-smallcaps">D</span>-Ribofuranose, 1,3,5-tribenzoate
- α-D-Ribofuranose,1,3,5-tribenzoate
- α-D-1,3,5-Tri-O-benzoyl-ribofuranose
