CAS 22226-73-9: (1S,15S)-6,20,21,22,26-pentamethoxy-16,31-dimethyl-8,24-dioxa-16,31-diazaheptacyclo[23.6.2.1~3,7~.1~9,13~.1~15,19~.0~23,34~.0~28,32~]hexatriaconta-3(36),4,6,9(35),10,12,19(34),20,22,25,27,32-dodecaene (non-preferred name)
Description:The chemical substance with the name "(1S,15S)-6,20,21,22,26-pentamethoxy-16,31-dimethyl-8,24-dioxa-16,31-diazaheptacyclo[23.6.2.1~3,7~.1~9,13~.1~15,19~.0~23,34~.0~28,32~]hexatriaconta-3(36),4,6,9(35),10,12,19(34),20,22,25,27,32-dodecaene" and CAS number "22226-73-9" is a complex organic compound characterized by a highly intricate polycyclic structure. It features multiple methoxy groups, which are known to enhance solubility and reactivity. The presence of both nitrogen and oxygen atoms in its structure indicates potential for diverse chemical interactions, including hydrogen bonding and coordination with metal ions. The stereochemistry, denoted by the (1S,15S) configuration, suggests specific spatial arrangements that can influence the compound's biological activity and reactivity. This compound's unique structural features may contribute to its potential applications in fields such as medicinal chemistry, materials science, or as a synthetic intermediate. However, due to its complexity, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C39H44N2O7
InChI:InChI=1/C39H44N2O7/c1-40-15-13-25-21-32(43-4)34-22-28(25)29(40)18-24-11-12-31(42-3)33(20-24)47-26-10-8-9-23(17-26)19-30-35-27(14-16-41(30)2)36(44-5)38(45-6)39(46-7)37(35)48-34/h8-12,17,20-22,29-30H,13-16,18-19H2,1-7H3/t29-,30-/m0/s1