CAS 2222612-31-7
:Benzenediazonium chloride
Description:
Benzenediazonium chloride is an organic compound characterized by the presence of a diazonium group (-N₂⁺) attached to a benzene ring, making it a member of the diazonium salts. It typically appears as a white to pale yellow crystalline solid and is known for its high reactivity, particularly in electrophilic aromatic substitution reactions. The compound is soluble in water and polar organic solvents, and it is often used in organic synthesis, particularly for the preparation of azo compounds through coupling reactions with activated aromatic systems. Benzenediazonium chloride is sensitive to heat and light, which can lead to decomposition, releasing nitrogen gas. Its reactivity allows it to serve as a versatile intermediate in the synthesis of dyes, pigments, and pharmaceuticals. However, due to its potential toxicity and the formation of carcinogenic compounds during its reactions, handling requires caution and appropriate safety measures.
Formula:C6H5N2·Cl
InChI:InChI=1S/C6H5N2.ClH/c7-8-6-4-2-1-3-5-6;/h1-5H;1H/q+1;/p-1
InChI key:InChIKey=CLRSZXHOSMKUIB-UHFFFAOYSA-M
SMILES:[N+](#N)C1=CC=CC=C1.[Cl-]
Synonyms:- Benzenediazonium, chloride (1:1)
- Chlorophenyldiazene
- Phenyldiazonium chloride
- Benzenediazonium chloride
- Benzenediazonium, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Chloro-2-phenyl-diazene-13C6
CAS:Controlled ProductApplications 1-Chloro-2-phenyl-diazene-13C6 is an intermediate in synthesizing N-Acetyl-S-(phenyl-13C6)-L-cysteine (A187357), a labelled N-Acetyl-S-phenyl-L-cysteine (P335600). It is an important metabolite of Benzene.
References Muller, G., et al.: Anal. Hazard. Subst. Biol. Mater., 5, 143 (1997)Formula:C6H5ClN2Color and Shape:NeatMolecular weight:146.526
