CAS 22227-25-4

3-(Trifluoromethyl)benzoic acid hydrazide

Description:

3-(Trifluoromethyl)benzoic acid hydrazide is an organic compound characterized by the presence of a hydrazide functional group attached to a benzoic acid moiety, which is further substituted with a trifluoromethyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The hydrazide functional group can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry and medicinal chemistry. It may also exhibit interesting pharmacological properties, although specific biological activities would depend on further research. The compound's molecular structure allows for potential applications in agrochemicals, pharmaceuticals, or as intermediates in organic synthesis. Safety data should be consulted for handling and usage, as compounds with trifluoromethyl groups can exhibit toxicity or environmental concerns.

Formula: C₈H₇F₃N₂O

InChI: InChI=1/C8H7F3N2O/c9-8(10,11)6-3-1-2-5(4-6)7(14)13-12/h1-4H,12H2,(H,13,14)

SMILES: c1cc(cc(c1)C(F)(F)F)C(=NN)O

Synonyms:

• 3-(Trifluoromethyl)benzene-1-carbohydrazide
• 3-(Trifluoromethyl)Benzohydrazide

3-(Trifluoromethyl)benzohydrazide

CAS: 22227-25-4

Formula: C₈H₇F₃N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 204.1492

Ref: IN-DA006ZFD

3-(Trifluoromethyl)benzhydrazide

CAS: 22227-25-4

3-(Trifluoromethyl)benzhydrazide

Formula: C₈H₇F₃N₂O

Purity: 97%

Color and Shape: off-white solid

Molecular weight: 204.15g/mol

Ref: 54-PC5311

3-(Trifluoromethyl)benzoic acid hydrazide

CAS: 22227-25-4

Formula: C₈H₇F₃N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 204.152

Ref: 10-F008430