CymitQuimica logo

CAS 222317-29-5

:

3-Bromo-2-methoxyquinoline

Description:
3-Bromo-2-methoxyquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 3-position and a methoxy group at the 2-position contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water. Its molecular formula reflects the presence of carbon, hydrogen, bromine, and oxygen atoms, which influences its reactivity and potential applications. 3-Bromo-2-methoxyquinoline can participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it of interest in synthetic organic chemistry. Additionally, compounds of this type may exhibit biological activity, which can be explored for potential pharmaceutical applications. As with many brominated compounds, care should be taken regarding their environmental impact and handling due to the potential for toxicity.
Formula:C10H8BrNO
InChI:InChI=1S/C10H8BrNO/c1-13-10-8(11)6-7-4-2-3-5-9(7)12-10/h2-6H,1H3
InChI key:InChIKey=RANIWICHNFHZMY-UHFFFAOYSA-N
SMILES:O(C)C1=NC2=C(C=C1Br)C=CC=C2
Synonyms:
  • Quinoline, 3-bromo-2-methoxy-
  • 3-Bromo-2-methoxyquinoline
Found 4 products.