CAS 222320-17-4
:(2E)-4-Methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide
Description:
(2E)-4-Methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide, with the CAS number 222320-17-4, is an organic compound characterized by its complex structure, which includes a pentanamide backbone with various functional groups. This compound features a ketone group (3-oxo) and an amide group (N-phenyl), indicating potential reactivity and interactions typical of amides. The presence of the phenylmethylene substituent suggests that it may exhibit significant aromatic character, which can influence its physical properties, such as solubility and melting point. The (2E) configuration indicates a specific geometric arrangement around the double bond, which can affect the compound's reactivity and stability. Generally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Additionally, the presence of multiple functional groups suggests potential for diverse chemical reactivity, including nucleophilic attacks and electrophilic substitutions. Overall, this compound's unique structure may lead to interesting applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C19H19NO2
InChI:InChI=1S/C19H19NO2/c1-14(2)18(21)17(13-15-9-5-3-6-10-15)19(22)20-16-11-7-4-8-12-16/h3-14H,1-2H3,(H,20,22)/b17-13+
InChI key:InChIKey=SMUFHBOCNIUNPT-GHRIWEEISA-N
SMILES:C(=C/C1=CC=CC=C1)(\C(NC2=CC=CC=C2)=O)/C(C(C)C)=O
Synonyms:- (2E)-4-Methyl-3-oxo-N-phenyl-2-(phenylmethylene)pentanamide
- Pentanamide, 4-methyl-3-oxo-N-phenyl-2-(phenylmethylene)-, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
