CAS 22237-12-3
:(3-Amino-4-methylphenyl)boronic acid, hydrochloride
Description:
(3-Amino-4-methylphenyl)boronic acid, hydrochloride is an organic compound characterized by the presence of a boronic acid functional group, an amino group, and a methyl-substituted aromatic ring. Its molecular structure features a phenyl ring with an amino group at the meta position and a methyl group at the para position relative to the boronic acid group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various chemical reactions. It is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals and as a building block in organic synthesis. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in the synthesis of complex molecules and in the development of sensors. Additionally, the compound may exhibit biological activity, which can be explored in the context of drug design and development. Proper handling and storage are essential due to its chemical reactivity and potential health hazards.
Formula:C7H10BNO2
InChI:InChI=1/C7H10BNO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,9H2,1H3
SMILES:Cc1ccc(cc1N)B(O)O
Synonyms:- 3-Amino-4-methylphenylboronic acid~3-Amino-p-tolylboronic acid
- 3-Amino-4-methylbenzeneboronic acid
- 5-(Dihydroxyboranyl)-2-Methylanilinium Chloride
- (3-Amino-4-Methylphenyl)Boronic Acid
- 3-Amino-4-Methylphenylboronic Acid Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-4-methylphenylboronic acid hydrochloride
CAS:Formula:C7H10BNO2Purity:98%Color and Shape:LiquidMolecular weight:150.97083-Amino-4-methylbenzeneboronic acid
CAS:3-Amino-4-methylbenzeneboronic acidFormula:C7H10BNO2Purity:≥95%Color and Shape:Cream SolidMolecular weight:150.97083-Amino-4-methylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H10BNO2Purity:97.0 to 114.0 %Color and Shape:White to Gray to Brown powder to crystalineMolecular weight:150.97(3-Amino-4-methylphenyl)boronic acid
CAS:Formula:C7H10BNO2Purity:95%Color and Shape:SolidMolecular weight:150.97



