CAS 2224-02-4

1,2-dithiolane-4-carboxylic acid

Description:

1,2-Dithiolane-4-carboxylic acid is a heterocyclic organic compound characterized by a five-membered ring containing two sulfur atoms and a carboxylic acid functional group. Its molecular structure features a dithiolane ring, which contributes to its unique chemical properties, including potential reactivity due to the presence of sulfur atoms that can participate in various chemical reactions, such as nucleophilic attacks. The carboxylic acid group enhances its solubility in polar solvents and allows for acid-base reactions. This compound is of interest in organic synthesis and may serve as a building block for more complex molecules. Additionally, the presence of sulfur in its structure can impart specific biological activities, making it a candidate for research in medicinal chemistry. Its CAS number, 2224-02-4, is a unique identifier that facilitates the search for information regarding its properties, safety data, and applications in scientific literature. Overall, 1,2-dithiolane-4-carboxylic acid is notable for its structural features and potential utility in various chemical contexts.

Formula: C₄H₆O₂S₂

InChI: InChI=1/C4H6O2S2/c5-4(6)3-1-7-8-2-3/h3H,1-2H2,(H,5,6)

InChI key: InChIKey=AYGMEFRECNWRJC-UHFFFAOYSA-N

SMILES: C1C(CSS1)C(=O)O

Synonyms:

• 1,2-Dithiacyclopentane-4-carboxylic acid
• Acide 1,2-Dithiolane-4-Carboxylique
• Asparagusic acid
• Ph 800/21

Asparagusic acid

CAS: 2224-02-4

Asparagusic acid is unique to asparagus.

Formula: C₄H₆O₂S₂

Purity: 98.45% - ≥98%

Color and Shape: Solid

Molecular weight: 150.22

Ref: TM-T10388

1,2-Dithiolane-4-carboxylicacid(6CI,7CI,8CI,9CI)

CAS: 2224-02-4

Formula: C₄H₆O₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 150.2192

Ref: IN-DA00BF0E

1,2-Dithiolane-4-Carboxylicacid

CAS: 2224-02-4

1,2-Dithiolane-4-Carboxylicacid

Purity: 95%

Molecular weight: 150.22g/mol

Ref: 54-OR1024071

Asparagusic acid

CAS: 2224-02-4

Asparagusic acid

Purity: ≥98%

Molecular weight: 150.22g/mol

Ref: 54-BUP09807

Asparagusic acid

CAS: 2224-02-4

Purity: 97%

Molecular weight: 150.210

Ref: 10-F811922