CAS 2224-83-1
:4-(4-chlorophenyl)-1H-2,3-benzoxazin-1-one
Description:
4-(4-Chlorophenyl)-1H-2,3-benzoxazin-1-one, with the CAS number 2224-83-1, is an organic compound characterized by its benzoxazine structure, which features a fused benzene and oxazine ring. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the 4-chlorophenyl group contributes to its chemical reactivity and may influence its biological activity, making it of interest in medicinal chemistry. The compound is likely to be moderately soluble in organic solvents, while its solubility in water may be limited due to its hydrophobic characteristics. Additionally, it may exhibit specific optical properties, such as fluorescence, depending on its molecular structure and environment. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance. Overall, 4-(4-chlorophenyl)-1H-2,3-benzoxazin-1-one represents a unique chemical entity with diverse potential applications.
Formula:C14H8ClNO2
InChI:InChI=1/C14H8ClNO2/c15-10-7-5-9(6-8-10)13-11-3-1-2-4-12(11)14(17)18-16-13/h1-8H
SMILES:c1ccc2c(c1)c(c1ccc(cc1)Cl)noc2=O
Synonyms:- 4-(p-Chlorophenyl)-1H-2,3-benzoxazin-1-one
- 4-(4-chlorophenyl)-2,3-benzoxazin-1-one
- 4-(4-chlorophenyl)-1H-2,3-benzoxazin-1-one
- 1H-2,3-Benzoxazin-1-one, 4-(4-chlorophenyl)-
- 4-(4-Chlorophenyl)-1H-benzo[D][1,2]oxazin-1-one
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
4-(4-Chlorophenyl)-1H-2,3-benzoxazin-1-one
CAS:Controlled ProductApplications 4-(4-Chlorophenyl)-1H-2,3-benzoxazin-1-one is a reagent used to prepare phthalimidines.
References Baddar, F. G., et al.: J. Chem. Soc., Perkin Trans. 1, 21, 2448 (1973)Formula:C14H8ClNO2Color and Shape:NeatMolecular weight:257.672

