CAS 222400-20-6
:Tomopenem
Description:
Tomopenem is a synthetic carbapenem antibiotic that exhibits broad-spectrum antibacterial activity, particularly against Gram-positive and Gram-negative bacteria. It is characterized by its β-lactam structure, which is essential for its mechanism of action, as it inhibits bacterial cell wall synthesis. Tomopenem is notable for its stability against various β-lactamases, enzymes produced by bacteria that confer resistance to many antibiotics. This stability enhances its efficacy against resistant strains. The compound is typically administered parenterally and is used in the treatment of serious infections, including those caused by multidrug-resistant organisms. Its pharmacokinetic properties include good tissue penetration and a relatively short half-life, necessitating multiple doses for effective therapeutic levels. Additionally, Tomopenem's safety profile is generally favorable, although, like other antibiotics, it may be associated with potential side effects such as gastrointestinal disturbances or allergic reactions. Ongoing research continues to evaluate its effectiveness and safety in various clinical settings.
Formula:C23H35N7O6S
InChI:InChI=1S/C23H35N7O6S/c1-10-17-16(11(2)31)21(34)30(17)18(22(35)36)19(10)37-13-6-14(28(3)9-13)20(33)29-5-4-12(8-29)27-15(32)7-26-23(24)25/h10-14,16-17,31H,4-9H2,1-3H3,(H,27,32)(H,35,36)(H4,24,25,26)/t10-,11-,12+,13+,14+,16-,17-/m1/s1
InChI key:InChIKey=KEDAXBWZURNCHS-GPODMPQUSA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@@]([C@@H](C)O)(C2=O)[H])([C@@H](C)C1S[C@H]3C[C@@H](C(=O)N4C[C@@H](NC(CNC(=N)N)=O)CC4)N(C)C3)[H]
Synonyms:- (4R,5S,6S)-3-[[(3S,5S)-5-[[(3S)-3-[[2-[(Aminoiminomethyl)amino]acetyl]amino]-1-pyrrolidinyl]carbonyl]-1-methyl-3-pyrrolidinyl]thio]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
- 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[[(3S,5S)-5-[[(3S)-3-[[2-[(aminoiminomethyl)amino]acetyl]amino]-1-pyrrolidinyl]carbonyl]-1-methyl-3-pyrrolidinyl]thio]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-, (4R,5S,6S)-
- 1-Azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 3-[[(3S,5S)-5-[[(3S)-3-[[[(aminoiminomethyl)amino]acetyl]amino]-1-pyrrolidinyl]carbonyl]-1-methyl-3-pyrrolidinyl]thio]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-, (4R,5S,6S)-
- Antibiotic CS 023
- Cs-023
- R 1558
- R-115685
- R-1558,Ro-4098463
- Ro 4908463
- Tomopenem
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Tomopenem
CAS:Tomopenem is a penem antibiotic.Formula:C23H35N7O6SPurity:98%Color and Shape:SolidMolecular weight:537.63Tomopenem
CAS:Controlled ProductApplications Carbapenem Antibiotic.
References Shahid, M., et al.: Crit. Rev. Microbiol., 35, 81 (2009), Varma, M., et al.: J. Med. Chem., 52, 4844 (2009), Mallalieu, N., et al.: Brit. J. Clin. Pharmacol., 67, 469 (2009),Formula:C23H35N7O6SColor and Shape:NeatMolecular weight:537.632Tomopenem
CAS:Tomopenem is a carbapenem antibiotic, which is a product of synthetic origin with broad-spectrum antibacterial properties. It acts by inhibiting the synthesis of bacterial cell walls through binding to penicillin-binding proteins, thereby disrupting the structural integrity of the cell wall and leading to bacterial cell lysis and death.
Formula:C23H35N7O6SPurity:Min. 95%Molecular weight:537.63 g/mol


