CymitQuimica logo

CAS 222408-90-4

:

2-[2-(1-Chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazolidine-3-thione

Description:
2-[2-(1-Chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazolidine-3-thione is a chemical compound characterized by its complex structure, which includes a triazolidine ring and various functional groups. The presence of a thione group indicates that it contains a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The compound features a chlorinated cyclopropyl moiety and a chlorophenyl group, which may influence its lipophilicity and interaction with biological targets. Its hydroxyl group suggests potential for hydrogen bonding, which can affect solubility and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of multiple halogen atoms could enhance its stability and alter its electronic properties. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research in various chemical and biological applications.
Formula:C14H17Cl2N3OS
InChI:InChI=1S/C14H17Cl2N3OS/c15-11-4-2-1-3-10(11)7-14(20,13(16)5-6-13)8-19-12(21)17-9-18-19/h1-4,18,20H,5-9H2,(H,17,21)
InChI key:InChIKey=PCARSQBZDYOIPU-UHFFFAOYSA-N
SMILES:C(CC1=C(Cl)C=CC=C1)(CN2C(=S)NCN2)(O)C3(Cl)CC3
Synonyms:
  • 1,2,4-Triazolidine-3-thione, 2-[2-(1-chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-
  • 2-[2-(1-Chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl]-1,2,4-triazolidine-3-thione
  • 2-(2-(1-Chlorocyclopropyl)-3-(2-chlorophenyl)-2-hydroxypropyl)-1,2,4-triazolidine-3-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.