CAS 22246-02-2

6-chloro-3,4-dihydroisoquinolin-1(2H)-one

Description:

6-Chloro-3,4-dihydroisoquinolin-1(2H)-one is a chemical compound characterized by its isoquinoline structure, which features a bicyclic system composed of a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 6-position and a carbonyl group at the 1-position contributes to its unique reactivity and potential biological activity. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. It may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. The compound's structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its synthesis and characterization involve standard organic chemistry techniques, including reactions that introduce the chlorine substituent and the formation of the isoquinoline framework. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₈ClNO

InChI: InChI=1/C9H8ClNO/c10-7-1-2-8-6(5-7)3-4-11-9(8)12/h1-2,5H,3-4H2,(H,11,12)

SMILES: c1cc2c(CCNC2=O)cc1Cl

Synonyms:

• 1(2H)-isoquinolinone, 6-chloro-3,4-dihydro-

6-Chloro-3,4-dihydroisoquinolin-1(2H)-one

CAS: 22246-02-2

Formula: C₉H₈ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 181.6189

Ref: IN-DA007P1L

6-Chloro-3,4-dihydro-2H-isoquinolin-1-one

CAS: 22246-02-2

6-Chloro-3,4-dihydro-2H-isoquinolin-1-one

Formula: C₉H₈ClNO

Purity: 98%

Color and Shape: light brown to brown solid

Molecular weight: 181.62g/mol

Ref: 54-OR939226

6-Chloro-3,4-dihydroisoquinolin-1(2H)-one

CAS: 22246-02-2

Formula: C₉H₈ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 181.62

Ref: 10-F214750