CAS 22246-66-8

6-methoxyisoindolinone

Description:

6-Methoxyisoindolinone is a chemical compound characterized by its isoindolinone structure, which features a bicyclic system comprising a benzene ring fused to a five-membered lactam. This compound is notable for the presence of a methoxy group (-OCH3) at the 6-position of the isoindolinone ring, which can influence its chemical reactivity and biological activity. Typically, isoindolinones exhibit a range of properties, including potential applications in medicinal chemistry due to their ability to interact with various biological targets. The methoxy substitution can enhance lipophilicity, potentially affecting the compound's solubility and permeability. Additionally, 6-methoxyisoindolinone may exhibit fluorescence properties, making it useful in certain analytical applications. The compound's molecular formula and structure contribute to its stability and reactivity, which can be further explored in synthetic and pharmaceutical contexts. Overall, 6-methoxyisoindolinone represents a versatile scaffold in organic chemistry and drug development, with ongoing research into its potential therapeutic applications.

Formula: C₉H₉NO₂

InChI: InChI=1/C9H9NO2/c1-12-7-3-2-6-5-10-9(11)8(6)4-7/h2-4H,5H2,1H3,(H,10,11)

SMILES: COc1ccc2CN=C(c2c1)O

Synonyms:

• 6-Methoxyisoindolin-1-One
• 5-methoxy-2,3-dihydro-1H-isoindol-1-one
• 6-methoxy-2,3-dihydro-1H-isoindol-1-one
• 1H-Isoindol-1-one, 2,3-dihydro-6-methoxy-

5-Methoxy-2,3-dihydro-isoindol-1-one

CAS: 22246-66-8

Formula: C₉H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1733

Ref: IN-DA00BEW8

5-Methoxy-2,3-dihydro-isoindol-1-one

CAS: 22246-66-8

5-Methoxy-2,3-dihydro-isoindol-1-one

Purity: 98%

Molecular weight: 163.17g/mol

Ref: 54-OR962968

5-Methoxy-2,3-Dihydro-Isoindol-1-One

CAS: 22246-66-8

5-Methoxy-2,3-Dihydro-Isoindol-1-One is a chemical compound that can be used as a building block in organic synthesis. It is an intermediate in the synthesis of various pharmaceuticals and other organic compounds. 5-Methoxy-2,3-Dihydro-Isoindol-1-One is soluble in ethanol, methanol, diethyl ether, chloroform, and benzene. This chemical has been classified as being safe for human use by the FDA.

Formula: C₉H₉NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 163.17 g/mol

Ref: 3D-FM52087

5-Methoxyisoindolin-1-one

CAS: 22246-66-8

Formula: C₉H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.176

Ref: 10-F218436