CAS 2225146-51-8

1H-Pyrrolo[3,2-b]pyridin-3-ol, hydrochloride (1:1)

Description:

1H-Pyrrolo[3,2-b]pyridin-3-ol, hydrochloride (1:1), with the CAS number 2225146-51-8, is a chemical compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The hydroxyl group at the 3-position of the pyrrolo ring contributes to its potential reactivity and biological activity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific applications and mechanisms of action would depend on ongoing research, as it may interact with various biological targets. As with many chemical substances, proper handling and safety precautions are essential, particularly in laboratory settings, to mitigate any potential hazards associated with its use.

Formula: C₇H₆N₂O·ClH

InChI: InChI=1S/C7H6N2O.ClH/c10-6-4-9-5-2-1-3-8-7(5)6;/h1-4,9-10H;1H

InChI key: InChIKey=VPPFUIVRTDQZAC-UHFFFAOYSA-N

SMILES: OC=1C=2C(=CC=CN2)NC1.Cl

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridin-3-ol, hydrochloride (1:1)

1H-Pyrrolo[3,2-b]pyridin-3-ol hydrochloride

CAS: 2225146-51-8

Versatile small molecule scaffold

Formula: C₇H₇ClN₂O

Purity: Min. 95%

Molecular weight: 170.6 g/mol

Ref: 3D-APD14651