CAS 2225146-89-2

Benzenemethanamine, 4-amino-3-methoxy-, hydrochloride (1:2)

Description:

Benzenemethanamine, 4-amino-3-methoxy-, hydrochloride (1:2), also known by its CAS number 2225146-89-2, is a chemical compound characterized by its amine and methoxy functional groups attached to a benzene ring. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The presence of the amino group suggests potential basic properties, while the methoxy group can influence its reactivity and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many amine derivatives, it may also participate in hydrogen bonding, affecting its physical properties and interactions in solution. Proper handling and storage conditions are essential to maintain its integrity and efficacy in research or application settings.

Formula: C₈H₁₂N₂O·2ClH

InChI: InChI=1S/C8H12N2O.2ClH/c1-11-8-4-6(5-9)2-3-7(8)10;;/h2-4H,5,9-10H2,1H3;2*1H

InChI key: InChIKey=OAVXBBXDBVHQHE-UHFFFAOYSA-N

SMILES: O(C)C1=CC(CN)=CC=C1N.Cl

Synonyms:

• Benzenemethanamine, 4-amino-3-methoxy-, hydrochloride (1:2)

4-(Aminomethyl)-2-methoxyaniline dihydrochloride

CAS: 2225146-89-2

Versatile small molecule scaffold

Formula: C₈H₁₄Cl₂N₂O

Purity: Min. 95%

Molecular weight: 225.1 g/mol

Ref: 3D-APD14689