CymitQuimica logo

CAS 222530-34-9

:

(1R,3S)-3-[(tert-butoxycarbonyl)amino]cyclohexanecarboxylic acid

Description:
(1R,3S)-3-[(tert-butoxycarbonyl)amino]cyclohexanecarboxylic acid is an amino acid derivative characterized by its cyclohexane ring structure, which contributes to its unique stereochemistry and spatial configuration. The presence of the tert-butoxycarbonyl (Boc) group indicates that this compound is likely used as a protecting group in peptide synthesis, allowing for selective reactions without interfering with the amino functionality. The compound features both an amino group and a carboxylic acid group, making it a zwitterionic species under physiological conditions. Its stereochemical designation (1R,3S) suggests specific spatial arrangements of substituents around the chiral centers, which can significantly influence its biological activity and interaction with enzymes or receptors. This compound is typically utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility and stability can vary depending on the solvent and pH, which are important considerations for its application in laboratory settings.
Formula:C12H21NO4
InChI:InChI=1/C12H21NO4/c1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15/h8-9H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9+/m1/s1
InChI key:JSGHMGKJNZTKGF-DTWKUNHWSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H](C1)C(=O)O
Synonyms:
  • (1R,3S)-3-(tert-butoxycarbonylamino)cyclohexanecarboxylic acid
Found 5 products.