CAS 222541-76-6

4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride

Description:

4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride is an organic compound characterized by its functional groups and structural features. It contains a benzoyl chloride moiety, which is known for its reactivity due to the presence of the acyl chloride functional group, making it a useful intermediate in organic synthesis. The oxadiazole ring contributes to the compound's heterocyclic nature, potentially imparting unique chemical properties such as increased stability and specific reactivity patterns. The methyl group on the oxadiazole ring can influence the compound's solubility and reactivity. This compound is typically used in the synthesis of various pharmaceuticals and agrochemicals, where it may serve as a building block for more complex molecules. Its reactivity allows it to participate in nucleophilic substitution reactions, making it valuable in the development of new chemical entities. Safety precautions should be observed when handling this compound, as it may be corrosive and harmful upon exposure.

Formula: C₁₀H₇ClN₂O₂

InChI: InChI=1/C10H7ClN2O2/c1-6-12-10(13-15-6)8-4-2-7(3-5-8)9(11)14/h2-5H,1H3

SMILES: Cc1nc(c2ccc(cc2)C(=O)Cl)no1

4-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride

CAS: 222541-76-6

4-(5-Methyl-1,2,4-oxadiazol-3-yl)benzoyl chloride

Formula: C₁₀H₇ClN₂O₂

Purity: tech

Color and Shape: brown solid

Molecular weight: 222.63g/mol

Ref: 54-OR4391

4-(5-Methyl-[1,2,4]oxadiazol-3-yl)-benzoyl chloride

CAS: 222541-76-6

Formula: C₁₀H₇ClN₂O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 222.63

Ref: 10-F475825