CAS 22259-53-6: Indole-3-methanamine
Description:Indole-3-methanamine, with the CAS number 22259-53-6, is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. This compound features an amine group (-NH2) attached to the methylene (-CH2-) carbon of the indole, making it a derivative of indole. Indole-3-methanamine is typically a colorless to pale yellow solid or liquid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols, owing to the presence of the amine group, which can engage in hydrogen bonding. This compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities, including effects on neurotransmitter systems. Additionally, it may serve as an intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H10N2
InChI:InChI=1S/C9H10N2/c10-5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5,10H2
InChI key:InChIKey=JXYGLMATGAAIBU-UHFFFAOYSA-N
SMILES:NCC1=CNC=2C=CC=CC21
- Synonyms:
- (1H-Indol-3-Yl)Methanamine
- 1-(1H-indol-3-yl)methanamine
- 1H-Indol-3-ylmethanamine
- 1H-Indole-3-methanamine
- 3-(Aminomethyl)indole
- 3-Indoylmethanamine
- 3-Methyl-1H-indol-1-amine
- Indole, 3-(aminomethyl)-
- Indole-3-methanamine
