CAS 222639-41-0

(4-Fluoro-^a-tolulenesulfonyl)acetic acid

Description:

(4-Fluoro-^a-tolulenesulfonyl)acetic acid, identified by its CAS number 222639-41-0, is a chemical compound characterized by the presence of a sulfonyl group attached to a toluene derivative, along with a carboxylic acid functional group. The presence of the fluorine atom at the para position of the toluene ring enhances its reactivity and may influence its biological activity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its sulfonyl group contributes to its potential as a leaving group in various chemical reactions, making it valuable in synthetic chemistry. Additionally, the carboxylic acid functionality allows for hydrogen bonding and solubility in polar solvents, which can be advantageous in various applications. Overall, (4-Fluoro-^a-tolulenesulfonyl)acetic acid is a versatile compound with significant implications in chemical research and development.

Formula: C₉H₉FO₄S

InChI: InChI=1/C9H9FO4S/c10-8-3-1-7(2-4-8)5-15(13,14)6-9(11)12/h1-4H,5-6H2,(H,11,12)

SMILES: c1cc(ccc1CS(=O)(=O)CC(=O)O)F

Synonyms:

• Acetic Acid, 2-[[(4-Fluorophenyl)Methyl]Sulfonyl]-
• [(4-Fluorobenzyl)Sulfonyl]Acetic Acid

[(4-Fluorobenzyl)sulfonyl]acetic acid

CAS: 222639-41-0

Formula: C₉H₉FO₄S

Molecular weight: 232.2288

Ref: IN-DA003BVV