CAS 22268-13-9
:Versiconol
Description:
Versiconol, with the CAS number 22268-13-9, is a chemical compound that belongs to the class of secondary metabolites produced by certain fungi, particularly those in the genus Aspergillus. It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Versiconol is known for its role in the biosynthesis of other important compounds, such as mycotoxins and pigments. It exhibits antifungal properties, making it of interest in agricultural and pharmaceutical applications. Additionally, its structure may include hydroxyl groups, which can enhance its solubility in polar solvents. The compound's stability and reactivity can vary depending on environmental conditions, such as pH and temperature. Research into versiconol continues to explore its potential uses and mechanisms of action, particularly in relation to its effects on human health and its ecological role in fungal metabolism.
Formula:C18H16O8
InChI:InChI=1S/C18H16O8/c19-2-1-7(6-20)13-12(23)5-10-15(17(13)25)18(26)14-9(16(10)24)3-8(21)4-11(14)22/h3-5,7,19-23,25H,1-2,6H2/t7-/m1/s1
InChI key:InChIKey=ZLIRCPWCWHTYNP-SSDOTTSWSA-N
SMILES:O=C1C=2C(C(=O)C=3C1=CC(O)=CC3O)=C(O)C([C@H](CCO)CO)=C(O)C2
Synonyms:- Anthraquinone, 1,3,6,8-tetrahydroxy-2-[3-hydroxy-1-(hydroxymethyl)propyl]-, (-)-
- Versiconol
- 9,10-Anthracenedione, 1,3,6,8-tetrahydroxy-2-[(1S)-3-hydroxy-1-(hydroxymethyl)propyl]-
- 9,10-Anthracenedione, 1,3,6,8-tetrahydroxy-2-[3-hydroxy-1-(hydroxymethyl)propyl]-, (S)-
- 1,3,6,8-Tetrahydroxy-2-[(1S)-3-hydroxy-1-(hydroxymethyl)propyl]-9,10-anthracenedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Versiconol
CAS:<p>Versiconol is a useful organic compound for research related to life sciences. The catalog number is T125302 and the CAS number is 22268-13-9.</p>Formula:C18H16O8Color and Shape:SolidMolecular weight:360.318
