CAS 22268-16-2
:Altersolanol A
Description:
Altersolanol A, with the CAS number 22268-16-2, is a naturally occurring compound classified as a secondary metabolite. It is primarily derived from certain fungal species, particularly those belonging to the genus *Penicillium*. This compound is characterized by its complex polycyclic structure, which contributes to its biological activity. Altersolanol A exhibits notable antimicrobial properties, making it of interest in pharmaceutical research for potential applications in treating infections. Additionally, it has been studied for its effects on various biological systems, including its potential role in modulating cellular processes. The compound's solubility and stability can vary depending on environmental conditions, which is an important consideration for its practical applications. As with many natural products, Altersolanol A's synthesis and extraction can be challenging, prompting ongoing research into more efficient methods of production. Overall, Altersolanol A represents a significant area of study within natural product chemistry, with implications for drug discovery and development.
Formula:C16H16O8
InChI:InChI=1S/C16H16O8/c1-16(23)14(21)10-9(13(20)15(16)22)12(19)8-6(11(10)18)3-5(24-2)4-7(8)17/h3-4,13-15,17,20-23H,1-2H3/t13-,14+,15+,16-/m0/s1
InChI key:InChIKey=VSMBLBOUQJNJIL-JJXSEGSLSA-N
SMILES:O=C1C2=C(C(=O)C=3C1=C(O)C=C(OC)C3)[C@@H](O)[C@](C)(O)[C@H](O)[C@H]2O
Synonyms:- (1R,2S,3R,4S)-1,2,3,4-Tetrahydro-1,2,3,4,5-pentahydroxy-7-methoxy-2-methyl-9,10-anthracenedione
- 9,10-Anthracenedione, 1,2,3,4-tetrahydro-1,2,3,4,5-pentahydroxy-7-methoxy-2-methyl-, (1.alpha.,2.beta.,3.beta.,4.alpha.)-
- 9,10-Anthracenedione, 1,2,3,4-tetrahydro-1,2,3,4,5-pentahydroxy-7-methoxy-2-methyl-, (1R,2S,3R,4S)-
- 9,10-Anthracenedione, 1,2,3,4-tetrahydro-1,2,3,4,5-pentahydroxy-7-methoxy-2-methyl-, [1R-(1α,2β,3β,4α)]-
- Altersolanol A
- Anthraquinone, 1,2,3,4-tetrahydro-1α,2β,3β,4α,5-pentahydroxy-7-methoxy-2-methyl-
- NSC 173943
- Stemphylin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Altersolanol A
CAS:Altersolanol A (Stemphylin; NSC 173943) demonstrates effective antimicrobial properties, inhibiting the growth of Bacillus subtilis and Pseudomonas aeruginosa with a minimum inhibitory concentration (MIC) ranging from 25-100 μg/mL. Additionally, it shows no phytotoxic effects on Taxus at a concentration of 4 μg/μL.Formula:C16H16O8Color and Shape:SolidMolecular weight:336.29


