CAS 2227-57-8

3-(4-methoxyphenyl)prop-2-ynoic acid

Description:

3-(4-Methoxyphenyl)prop-2-ynoic acid, also known by its CAS number 2227-57-8, is an organic compound characterized by its unique structure, which includes a propyne moiety and a methoxy-substituted phenyl group. This compound features a triple bond between the second and third carbon atoms of the propynoic acid chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. Typically, compounds of this nature exhibit properties such as acidity due to the carboxylic acid functional group, which can participate in hydrogen bonding and affect their interaction with other molecules. Additionally, the aromatic ring can provide stability and influence the compound's electronic properties. 3-(4-Methoxyphenyl)prop-2-ynoic acid may be utilized in various fields, including pharmaceuticals and materials science, due to its potential as a building block in the synthesis of more complex organic molecules.

Formula: C₁₀H₈O₃

InChI: InChI=1/C10H8O3/c1-13-9-5-2-8(3-6-9)4-7-10(11)12/h2-3,5-6H,1H3,(H,11,12)

SMILES: COc1ccc(cc1)C#CC(=O)O

Synonyms:

• 2-Propynoic Acid, 3-(4-Methoxyphenyl)-

3-(4-Methoxyphenyl)-2-propynoic Acid

CAS: 2227-57-8

Formula: C₁₀H₈O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 176.1687

Ref: IN-DA00BV8K

3-(4-Methoxyphenyl)prop-2-ynoic acid

CAS: 2227-57-8

3-(4-Methoxyphenyl)prop-2-ynoic acid

Purity: 95%

Molecular weight: 176.16872g/mol

Ref: 54-OR94862

3-(4-Methoxyphenyl)propiolic acid

CAS: 2227-57-8

Formula: C₁₀H₈O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.171

Ref: 10-F233099

3-(4-Methoxyphenyl)-2-propynoic Acid

Controlled Product

CAS: 2227-57-8

Applications 3-(4-Methoxyphenyl)-2-propynoic Acid (cas# 2227-57-8) is a useful reagent for preparing bis(phenylethynyl)benzenes.
References Ryu, B., et al.: Asian J. Org. Chem., 9, 1754 (2020)

Formula: C₁₀H₈O₃

Color and Shape: Neat

Molecular weight: 176.17

Ref: TR-M228255

3-(4-Methoxyphenyl)propiolic acid

CAS: 2227-57-8

3-(4-Methoxyphenyl)propiolic acid is a triarylbismuth carboxylate that is produced by the reaction of 3-(4-methoxyphenyl)propionic acid with triaryl bismuth. The molecule has a diameter of ˜1.3 nm and exhibits strong diffraction peaks at 2θ=25.5°, 2θ=28.0°, and 2θ=30.2° in the IR spectrum. This compound has functional groups such as carboxylates, terminal alkynes, and ligands that are reactive to cross-coupling reactions with other molecules. Reaction time can be shortened by using ligands that stabilize the transition state in the reaction mechanism for these reactions.

Formula: C₁₀H₈O₃

Purity: Min. 95%

Molecular weight: 176.17 g/mol

Ref: 3D-CAA22757