CAS 222714-33-2

4-[(1S)-1-aminoethyl]benzoic acid

Description:

4-[(1S)-1-aminoethyl]benzoic acid, also known as a derivative of benzoic acid, features a benzoic acid moiety substituted with an aminoethyl group at the para position. This compound is characterized by its carboxylic acid functional group (-COOH) and an amino group (-NH2) that is attached to a two-carbon ethyl chain, which is further connected to a chiral carbon center. The presence of these functional groups contributes to its potential as a biological molecule, possibly influencing its solubility, reactivity, and interaction with biological systems. The stereochemistry indicated by the (1S) designation suggests that the aminoethyl group has a specific spatial arrangement, which can affect the compound's pharmacological properties. This compound may exhibit properties such as being a potential ligand in biochemical applications or serving as a building block in organic synthesis. Its unique structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₉H₁₁NO₂

InChI: InChI=1/C9H11NO2/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-6H,10H2,1H3,(H,11,12)/t6-/m0/s1

Synonyms:

• (S)-4-(1-Aminoethyl)benzoic acid

(S)-4-(1-Aminoethyl)benzoic acid

CAS: 222714-33-2

Formula: C₉H₁₁NO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 165.1891

Ref: IN-DA0037JQ

(S)-4-(1-Aminoethyl)benzoic acid

CAS: 222714-33-2

(S)-4-(1-Aminoethyl)benzoic acid

Purity: 96%

Molecular weight: 165.19g/mol

Ref: 54-OR76071

(S)-4-(1-Aminoethyl)benzoic acid

CAS: 222714-33-2

Purity: 96%

Molecular weight: 165.19

Ref: 10-F788316