CAS 2227199-06-4

2-Pyrrolidinemethanamine, N,N-dimethyl-, hydrochloride (1:2), (2R)-

Description:

2-Pyrrolidinemethanamine, N,N-dimethyl-, hydrochloride (1:2), (2R)- is a chemical compound characterized by its pyrrolidine ring structure, which contributes to its cyclic amine properties. This substance features a dimethylamino group attached to a methanamine moiety, enhancing its basicity and potential for forming hydrogen bonds. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, making it useful in various applications, including pharmaceuticals and research. The (2R)- designation indicates its specific stereochemistry, which can influence its biological activity and interactions with receptors. This compound may exhibit properties typical of amines, such as being a nucleophile and participating in various chemical reactions, including alkylation and acylation. Its safety profile, handling precautions, and specific applications would depend on its intended use, and it is essential to consult relevant safety data sheets and regulatory guidelines when working with this substance.

Formula: C₇H₁₆N₂·2ClH

InChI: InChI=1S/C7H16N2.2ClH/c1-9(2)6-7-4-3-5-8-7;;/h7-8H,3-6H2,1-2H3;2*1H/t7-;;/m1../s1

InChI key: InChIKey=WYOMVPNXWDCQRG-XCUBXKJBSA-N

SMILES: C(N(C)C)[C@H]1CCCN1.Cl

Synonyms:

• 2-Pyrrolidinemethanamine, N,N-dimethyl-, hydrochloride (1:2), (2R)-

N,N-Dimethyl-1-[(2R)-pyrrolidin-2-yl]methanamine dihydrochloride

CAS: 2227199-06-4

Versatile small molecule scaffold

Formula: C₇H₁₈Cl₂N₂

Purity: Min. 95%

Molecular weight: 201.13 g/mol

Ref: 3D-CPD19906