CymitQuimica logo

CAS 22272-20-4

:

2-chloro-3-(dodecylamino)naphthalene-1,4-dione

Description:
2-Chloro-3-(dodecylamino)naphthalene-1,4-dione, with the CAS number 22272-20-4, is an organic compound characterized by its naphthalene backbone substituted with a chloro group and a dodecylamino side chain. This compound typically exhibits a yellow to orange color due to the presence of the naphthoquinone structure, which is known for its ability to undergo redox reactions. The dodecylamino group contributes to its hydrophobic properties, making it more soluble in organic solvents than in water. The presence of the chlorine atom can influence its reactivity, potentially allowing for further chemical modifications. This compound may have applications in various fields, including materials science and organic synthesis, due to its unique structural features. Additionally, its properties may be affected by factors such as temperature and solvent environment, which can influence its stability and reactivity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C22H30ClNO2
InChI:InChI=1/C22H30ClNO2/c1-2-3-4-5-6-7-8-9-10-13-16-24-20-19(23)21(25)17-14-11-12-15-18(17)22(20)26/h11-12,14-15,24H,2-10,13,16H2,1H3
Synonyms:
  • 2-chloro-3-(dodecylamino)-1,4-dihydronaphthalene-1,4-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.