CAS 2227204-78-4

1H-Pyrrolo[2,3-b]pyridin-3-amine, 4-chloro-, hydrochloride (1:2)

Description:

1H-Pyrrolo[2,3-b]pyridin-3-amine, 4-chloro-, hydrochloride (1:2) is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features a chlorine substituent at the 4-position of the pyridine ring, contributing to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the amino group at the 3-position of the pyrrole ring may facilitate interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential for diverse interactions, which could be explored for therapeutic purposes. Its CAS number, 2227204-78-4, allows for precise identification in chemical databases and literature. Overall, this compound exemplifies the complexity and versatility of nitrogen-containing heterocycles in organic chemistry.

Formula: C₇H₆ClN₃·2ClH

InChI: InChI=1S/C7H6ClN3.2ClH/c8-4-1-2-10-7-6(4)5(9)3-11-7;;/h1-3H,9H2,(H,10,11);2*1H

InChI key: InChIKey=ACJYMXBYFZYHKT-UHFFFAOYSA-N

SMILES: ClC1=C2C(=NC=C1)NC=C2N.Cl

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridin-3-amine, 4-chloro-, hydrochloride (1:2)

4-chloro-1H-pyrrolo[2,3-b]pyridin-3-amine dihydrochloride

CAS: 2227204-78-4

Formula: C₇H₈Cl₃N₃

Purity: 96%

Molecular weight: 240.5175

Ref: IN-DA01JUDI

4-Chloro-1H-pyrrolo[2,3-b]pyridin-3-amine dihydrochloride

CAS: 2227204-78-4

Purity: 96%

Molecular weight: 240.5099945

Ref: 10-F625352