
CAS 2227205-27-6
:Methanone, 3-azetidinyl(3-hydroxy-1-pyrrolidinyl)-, hydrochloride (1:1)
Description:
Methanone, 3-azetidinyl(3-hydroxy-1-pyrrolidinyl)-, hydrochloride (1:1), identified by the CAS number 2227205-27-6, is a chemical compound that features a complex molecular structure incorporating both azetidine and pyrrolidine moieties. This substance is characterized by its hydrochloride salt form, which enhances its solubility in water and may influence its pharmacological properties. The presence of the azetidine ring contributes to its potential biological activity, while the hydroxyl group on the pyrrolidine ring may play a role in hydrogen bonding and interactions with biological targets. As a hydrochloride salt, it typically exhibits improved stability and bioavailability compared to its free base form. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could interact with various biological pathways. However, specific data regarding its toxicity, efficacy, and applications would require further investigation and research.
Formula:C8H14N2O2·ClH
InChI:InChI=1S/C8H14N2O2.ClH/c11-7-1-2-10(5-7)8(12)6-3-9-4-6;/h6-7,9,11H,1-5H2;1H
InChI key:InChIKey=BCYCATSJTJWESO-UHFFFAOYSA-N
SMILES:C(=O)(N1CC(O)CC1)C2CNC2.Cl
Synonyms:- Methanone, 3-azetidinyl(3-hydroxy-1-pyrrolidinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.