CAS: 2227206-40-6
Description:The chemical substance with the CAS number 2227206-40-6 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds can be characterized by their molecular formula, structure, physical properties (such as melting point, boiling point, and solubility), and chemical behavior (including reactivity and stability). Additionally, safety data, including toxicity and handling precautions, are crucial for understanding the substance's potential hazards. If this compound is part of a specialized field, such as pharmaceuticals or materials science, its characteristics may include specific functional groups that impart unique properties or biological activity. For precise information, including its applications and regulatory status, consulting specialized literature or databases is recommended.
Formula:C6H13NO
InChI:InChI=1S/C6H13NO/c1-4(2)6-5(7)3-8-6/h4-6H,3,7H2,1-2H3
InChI key:InChIKey=XLWOTGBMPXQMNS-UHFFFAOYSA-N
SMILES:O1CC(N)C1C(C)C
