CAS 2227272-84-4

Benzene, 1-bromo-3-(2,2-dibromoethenyl)-5-(1-methylethyl)-

Description:

Benzene, 1-bromo-3-(2,2-dibromoethenyl)-5-(1-methylethyl)- is an organic compound characterized by its complex structure, which includes a benzene ring substituted with various functional groups. The presence of bromine atoms indicates that it is a halogenated compound, which can influence its reactivity and physical properties. The compound features a 2,2-dibromoethenyl group, contributing to its potential applications in organic synthesis and materials science. The isopropyl group (1-methylethyl) adds to its hydrophobic character, affecting solubility in different solvents. As a brominated aromatic compound, it may exhibit unique electronic properties and reactivity patterns, making it of interest in fields such as medicinal chemistry and agrochemicals. Additionally, the presence of multiple bromine atoms can enhance its biological activity, but also raises concerns regarding environmental persistence and toxicity. Overall, this compound exemplifies the complexity and diversity of halogenated organic molecules, with potential implications in various chemical applications.

Formula: C₁₁H₁₁Br₃

InChI: InChI=1S/C11H11Br3/c1-7(2)9-3-8(5-11(13)14)4-10(12)6-9/h3-7H,1-2H3

InChI key: InChIKey=DTCIVDUCTXKACF-UHFFFAOYSA-N

SMILES: C(=C(Br)Br)C1=CC(C(C)C)=CC(Br)=C1

Synonyms:

• Benzene, 1-bromo-3-(2,2-dibromoethenyl)-5-(1-methylethyl)-
• 1-Bromo-3-(2,2-dibromoethenyl)-5-(1-methylethyl)benzene
• 1-Bromo-3-(2,2-dibromovinyl)-5-isopropylbenzene

1-Bromo-3-(2,2-dibromovinyl)-5-isopropylbenzene

CAS: 2227272-84-4

1-Bromo-3-(2,2-dibromovinyl)-5-isopropylbenzene

Purity: ≥95%

Color and Shape: Liquid

Molecular weight: 382.92g/mol

Ref: 54-OR300225