CAS 22273-09-2
:Curanium, 2,16,19,20-tetradehydro-4-methyl-17-oxo-, chloride (1:1), (4α,19E)-
Description:
Curanium, 2,16,19,20-tetradehydro-4-methyl-17-oxo-, chloride (1:1), (4α,19E)-, identified by the CAS number 22273-09-2, is a synthetic organic compound that belongs to a class of chemical substances known for their complex molecular structures and potential biological activity. This compound features a tetradehydro configuration, indicating the presence of multiple double bonds within its structure, which can influence its reactivity and stability. The presence of a methyl group and a ketone functional group (17-oxo) suggests that it may exhibit specific chemical properties, such as reactivity towards nucleophiles or electrophiles. The chloride ion indicates that it may participate in ionic interactions or serve as a leaving group in chemical reactions. Compounds like this are often studied for their potential applications in pharmaceuticals or agrochemicals, where their unique structural characteristics can lead to significant biological effects. However, detailed studies on its specific properties, biological activity, and safety profile would be necessary to fully understand its applications and implications in various fields.
Formula:C20H23N2O·Cl
InChI:InChI=1S/C20H22N2O.ClH/c1-3-13-11-22(2)9-8-20-16-6-4-5-7-17(16)21-19(20)15(12-23)14(13)10-18(20)22;/h3-7,12,14,18H,8-11H2,1-2H3;1H/b13-3-;/t14?,18-,20+,22-;/m0./s1
InChI key:InChIKey=CSLYOMBKQNZAED-LQPVJMRLSA-N
SMILES:C[N@@+]12[C@@]3([C@@]4(C(=C(C=O)C(C3)(/C(=C\C)/C1)[H])NC=5C4=CC=CC5)CC2)[H].[Cl-]
Synonyms:- 3,5-Ethano-3H-pyrrolo[2,3-d]carbazolium, 12-ethylidene-6-formyl-1,2,3a,4,5,7-hexahydro-3-methyl-, chloride, [3S-(3α,3aβ,5α,11bS*,12E)]-
- C-Curarine III, chloride
- Curanium, 2,16,19,20-tetradehydro-4-methyl-17-oxo-, chloride (1:1), (4α,19E)-
- Curanium, 2,16,19,20-tetradehydro-4-methyl-17-oxo-, chloride, (4α,19E)-
- Metvin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Fluorocurarine chloride
CAS:Fluorocurarine chloride (Metvine; Vincanine methyl chloride) is a plant metabolite that can be isolated from the Vinca plant.Formula:C20H23ClN2OColor and Shape:SolidMolecular weight:342.86
