CAS 22276-95-5
:5-Bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine
Description:
5-Bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate solubility in organic solvents, and its structure allows for various functionalization reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The molecular framework of 5-Bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine is known to exhibit biological activity, which may include antimicrobial or anticancer properties, although specific biological effects can vary based on the context of use. Its stability under standard laboratory conditions is generally good, but care should be taken to handle it in accordance with safety guidelines due to the presence of halogenated groups. Overall, this compound represents an interesting target for further research and development in various chemical applications.
Formula:C6H3BrClN3
InChI:InChI=1/C6H3BrClN3/c7-3-1-9-6-4(3)5(8)10-2-11-6/h1-2H,(H,9,10,11)
SMILES:c1c(c2c(Cl)nc[nH]c2n1)Br
Synonyms:- 7H-Pyrrolo[2,3-d]pyrimidine, 5-bromo-4-chloro-
- 7-Bromo-6-chloro-7-deazapurine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
7-Bromo-6-chloro-7-deazapurine, 97%
CAS:It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. TheFormula:C6H3BrClN3Purity:97%Molecular weight:232.475-bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine
CAS:Formula:C6H3BrClN3Purity:95%Color and Shape:SolidMolecular weight:232.46515-Bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine
CAS:5-Bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidineFormula:C6H3BrClN3Purity:≥95%Color and Shape: yellow solidMolecular weight:232.47g/mol5-Bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine
CAS:Formula:C6H3BrClN3Purity:95%Color and Shape:Solid, Crystalline PowderMolecular weight:232.47



