CAS 22282-58-2
:2-Iodo-3-methylpyridine
Description:
2-Iodo-3-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with an iodine atom at the 2-position and a methyl group at the 3-position. Its molecular formula is C7H8N I, indicating the presence of carbon, hydrogen, nitrogen, and iodine. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is known for its aromatic properties due to the pyridine ring, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. 2-Iodo-3-methylpyridine can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of more complex molecules. Additionally, it may exhibit biological activity, which can be explored for pharmaceutical applications. As with many halogenated compounds, it is important to handle 2-iodo-3-methylpyridine with care due to potential toxicity and environmental concerns.
Formula:C6H6IN
InChI:InChI=1/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3
SMILES:Cc1cccnc1I
Synonyms:- 2-Iodo-3-picoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Iodo-3-methylpyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H6INPurity:97%Color and Shape:Liquid, Clear pale yellow to yellowMolecular weight:219.03



