CAS 222834-30-2: Ragaglitazar

Description:Ragaglitazar is a synthetic compound that belongs to the class of dual PPAR (peroxisome proliferator-activated receptor) agonists, specifically targeting both PPAR-alpha and PPAR-gamma. This dual activity makes it of interest in the treatment of metabolic disorders, particularly type 2 diabetes and dyslipidemia, as it can help improve insulin sensitivity and lipid profiles. Ragaglitazar is characterized by its ability to modulate glucose and lipid metabolism, potentially leading to beneficial effects on body weight and cardiovascular health. The compound has been studied for its pharmacological properties, including its effects on glucose homeostasis and its anti-inflammatory actions. However, like many investigational drugs, it may also present side effects, which necessitate careful evaluation in clinical settings. Its chemical structure and specific interactions with PPAR receptors contribute to its therapeutic potential, but further research is essential to fully understand its efficacy and safety profile in human populations.

Formula:C₂₅H₂₅NO₅

InChI:InChI=1S/C25H25NO5/c1-2-29-24(25(27)28)17-18-11-13-19(14-12-18)30-16-15-26-20-7-3-5-9-22(20)31-23-10-6-4-8-21(23)26/h3-14,24H,2,15-17H2,1H3,(H,27,28)/t24-/m0/s1

InChI key:InChIKey=WMUIIGVAWPWQAW-DEOSSOPVSA-N

SMILES:O=C(O)C(OCC)CC1=CC=C(OCCN2C=3C=CC=CC3OC=4C=CC=CC42)C=C1