CAS 222856-41-9

4-Mercapto-1-methyl-2-pyrrolidinone

Description:

4-Mercapto-1-methyl-2-pyrrolidinone, identified by its CAS number 222856-41-9, is a chemical compound characterized by the presence of a thiol (-SH) group and a pyrrolidinone ring structure. This compound typically exhibits properties associated with both thiols and cyclic amides, including potential reactivity due to the thiol group, which can participate in various chemical reactions such as nucleophilic substitutions and disulfide bond formation. The presence of the methyl group on the nitrogen atom of the pyrrolidinone ring contributes to its steric and electronic properties, influencing its solubility and reactivity. 4-Mercapto-1-methyl-2-pyrrolidinone may be utilized in various applications, including as a reducing agent, in the synthesis of other chemical compounds, or in formulations requiring thiol functionalities. Its unique structure and properties make it of interest in fields such as organic chemistry, materials science, and pharmaceuticals. However, specific safety and handling guidelines should be followed due to the potential reactivity of thiol compounds.

Formula: C₅H₉NOS

InChI: InChI=1S/C5H9NOS/c1-6-3-4(8)2-5(6)7/h4,8H,2-3H2,1H3

InChI key: InChIKey=USUNCJIMTRQGFL-UHFFFAOYSA-N

SMILES: O=C1N(C)CC(S)C1

Synonyms:

• 2-Pyrrolidinone, 4-mercapto-1-methyl-
• 4-Mercapto-1-methyl-2-pyrrolidinone

1-Methyl-4-sulfanylpyrrolidin-2-one

CAS: 222856-41-9

Versatile small molecule scaffold

Formula: C₅H₉NOS

Purity: Min. 95%

Molecular weight: 131.2 g/mol

Ref: 3D-XIA85641