CAS 22288-79-5

methyl 3-(acetylamino)thiophene-2-carboxylate

Description:

Methyl 3-(acetylamino)thiophene-2-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features an acetylamino group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification and amidation. Methyl 3-(acetylamino)thiophene-2-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to its functional groups. Its structure suggests potential biological activity, making it of interest in pharmaceutical research. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Overall, this compound is significant in the context of synthetic organic chemistry and may serve as a precursor or intermediate in the synthesis of more complex molecules.

Formula: C₈H₉NO₃S

InChI: InChI=1/C8H9NO3S/c1-5(10)9-6-3-4-13-7(6)8(11)12-2/h3-4H,1-2H3,(H,9,10)

SMILES: CC(=Nc1ccsc1C(=O)OC)O

Synonyms:

• 2-Thiophenecarboxylic Acid, 3-(Acetylamino)-, Methyl Ester
• Methyl 3-acetamidothiophene-2-carboxylate

Methyl 3-acetamidothiophene-2-carboxylate

CAS: 22288-79-5

Formula: C₈H₉NO₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.2270

Ref: IN-DA003RQP

Methyl 3-acetamidothiophene-2-carboxylate

CAS: 22288-79-5

Methyl 3-acetamidothiophene-2-carboxylate

Purity: 99%

Molecular weight: 199.23g/mol

Ref: 54-OR95916

Methyl 3-acetamidothiophene-2-carboxylate

CAS: 22288-79-5

Purity: 98%

Molecular weight: 199.22

Ref: 10-F613834