CAS 22307-44-4

N-(2-amino-1,3-benzothiazol-6-yl)acetamide

Description:

N-(2-amino-1,3-benzothiazol-6-yl)acetamide, with the CAS number 22307-44-4, is an organic compound characterized by its benzothiazole structure, which incorporates both an amino group and an acetamide functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amide group. The benzothiazole moiety contributes to its biological activity, making it of interest in medicinal chemistry, particularly for its potential applications in pharmaceuticals. The compound may display various chemical reactivities, including the ability to participate in hydrogen bonding due to its amino and carbonyl functionalities. Additionally, it may exhibit fluorescence properties, which can be useful in biological imaging or as a probe in chemical assays. Overall, N-(2-amino-1,3-benzothiazol-6-yl)acetamide is a compound of interest for its structural features and potential applications in various fields, including drug development and biochemical research.

Formula: C₉H₉N₃OS

InChI: InChI=1/C9H9N3OS/c1-5(13)11-6-2-3-7-8(4-6)14-9(10)12-7/h2-4H,1H3,(H2,10,12)(H,11,13)

SMILES: CC(=Nc1ccc2c(c1)sc(=N)[nH]2)O

Synonyms:

• Acetamide, N-(2-amino-6-benzothiazolyl)-

N-(2-Aminobenzo[d]thiazol-6-yl)acetamide

CAS: 22307-44-4

Formula: C₉H₉N₃OS

Purity: 95%

Color and Shape: Solid

Molecular weight: 207.2523

Ref: IN-DA00BFVS

N-(2-Amino-1,3-benzothiazol-6-yl)acetamide

CAS: 22307-44-4

N-(2-Amino-1,3-benzothiazol-6-yl)acetamide

Purity: ≥95%

Molecular weight: 207.25g/mol

Ref: 54-OR480551

N-(2-Amino-benzothiazol-6-yl)-acetamide

CAS: 22307-44-4

6-Amino-2-aminobenzothiazole is a chemical substance that has been used as an antituberculosis drug. It is an antimicrobial agent that inhibits the growth of microorganisms by binding to their ribosomes and blocking protein synthesis. 6-Amino-2-aminobenzothiazole can be used for the treatment of tuberculosis and other bacterial infections. The compound binds to the 16S ribosomal RNA, inhibiting protein synthesis and cell division. 6-Amino-2-aminobenzothiazole also inhibits microbial growth by binding to DNA gyrase, which is an enzyme that maintains the integrity of bacterial DNA. This drug has been shown to be effective against Staphylococcus aureus, Pseudomonas aeruginosa, Escherichia coli, and Bacillus cereus.

Formula: C₉H₉N₃OS

Purity: Min. 95%

Molecular weight: 207.25 g/mol

Ref: 3D-XAA30744