CAS 22316-45-6
:Ethyl 3-[(5-chloro-2-nitrophenyl)phenylamino]-3-oxopropanoate
Description:
Ethyl 3-[(5-chloro-2-nitrophenyl)phenylamino]-3-oxopropanoate, identified by its CAS number 22316-45-6, is a chemical compound that belongs to the class of esters. It features a complex structure characterized by the presence of an ethyl ester group, a ketone functional group, and an aromatic amine moiety. The compound contains a chloro and a nitro substituent on the phenyl ring, which can influence its reactivity and biological activity. Typically, compounds of this nature may exhibit properties such as moderate solubility in organic solvents and potential bioactivity, making them of interest in medicinal chemistry and drug development. The presence of electron-withdrawing groups like chlorine and nitro groups can enhance the compound's electrophilicity, potentially affecting its interactions with biological targets. Additionally, the structural features may contribute to its stability and reactivity under various conditions. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C17H15ClN2O5
InChI:InChI=1S/C17H15ClN2O5/c1-2-25-17(22)11-16(21)19(13-6-4-3-5-7-13)15-10-12(18)8-9-14(15)20(23)24/h3-10H,2,11H2,1H3
InChI key:InChIKey=ZRYOWWCGEBQSKY-UHFFFAOYSA-N
SMILES:N(C(CC(OCC)=O)=O)(C1=C(N(=O)=O)C=CC(Cl)=C1)C2=CC=CC=C2
Synonyms:- Ethyl 3-[(5-Chloro-2-Nitrophenyl)(Phenyl)Amino]-3-Oxopropanoate
- Ethyl 3-[(5-chloro-2-nitrophenyl)phenylamino]-3-oxopropanoate
- Malonanilic acid, 5′-chloro-2′-nitro-N-phenyl-, ethyl ester
- Propanoic acid, 3-[(5-chloro-2-nitrophenyl)phenylamino]-3-oxo-, ethyl ester
- Ethyl 3-((5-chloro-2-nitrophenyl)phenylamino)-3-oxopropionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5'-Chloro-2'-nitro-N-phenyl-malonanilic Acid Ethyl Ester
CAS:Controlled ProductApplications Reagent used in the preparation of substituted Benzodiazepines.
Formula:C17H15ClN2O5Color and Shape:NeatMolecular weight:362.76

