CymitQuimica logo

CAS 22318-10-1

:

Evodol

Description:
Evodol, with the CAS number 22318-10-1, is a chemical compound primarily derived from the Evodia rutaecarpa plant, commonly known for its traditional medicinal uses. It is classified as a natural alkaloid and is known for its potential pharmacological properties, including anti-inflammatory and analgesic effects. Evodol exhibits a complex molecular structure, which contributes to its biological activity. The compound is typically found in the form of a white to off-white crystalline powder and is soluble in organic solvents, but its solubility in water is limited. Evodol's mechanism of action is still under investigation, but it is believed to interact with various biological pathways, making it of interest in the field of medicinal chemistry. Additionally, research into its safety profile and potential therapeutic applications continues, highlighting its significance in both traditional and modern medicine. As with any chemical substance, proper handling and safety precautions are essential when working with Evodol in laboratory or clinical settings.
Formula:C26H28O9
InChI:InChI=1S/C26H28O9/c1-22(2)17-16(28)18(29)24(4)13(25(17)11-32-15(27)9-14(25)34-22)5-7-23(3)19(12-6-8-31-10-12)33-21(30)20-26(23,24)35-20/h6,8,10,13-14,19-20,28H,5,7,9,11H2,1-4H3/t13-,14-,19-,20+,23-,24-,25-,26+/m0/s1
InChI key:InChIKey=SNGHLUWTFLYPMT-JPRNBFAHSA-N
SMILES:C[C@]12[C@]34[C@](C)([C@@H](OC(=O)[C@]3(O4)[H])C=5C=COC5)CC[C@@]1([C@]67C(=C(O)C2=O)C(C)(C)O[C@]6(CC(=O)OC7)[H])[H]
Synonyms:
  • 11H,13H-Oxireno[d]pyrano[4′,3′:3,3a]isobenzofuro[5,4-f][2]benzopyran-4,6,13(2H,5aH)-trione, 8-(3-furanyl)-4a,8,8a,9,10,10a,14,14a-octahydro-3-hydroxy-2,2,4a,8a-tetramethyl-, (4aR,4bR,5aS,8S,8aS,10aR,10bR,14aS)-
  • (4aR,4bR,5aS,8S,8aS,10aR,10bR,14aS)-8-(3-Furanyl)-4a,8,8a,9,10,10a,14,14a-octahydro-3-hydroxy-2,2,4a,8a-tetramethyl-11H,13H-oxireno[d]pyrano[4′,3′:3,3a]isobenzofuro[5,4-f][2]benzopyran-4,6,13(2H,5aH)-trione
  • Limonoic acid, 5,6-didehydro-6-hydroxy-, di-δ-lactone
  • Evodol
  • Limonin diosphenol
Found 6 products.