CAS 22318-80-5

Dihydropiceatannol

Description:

Dihydropiceatannol, with the CAS number 22318-80-5, is a chemical compound that belongs to the class of organic compounds known as terpenoids. It is characterized by its complex structure, which typically includes multiple rings and functional groups that contribute to its reactivity and potential applications. This compound is often studied for its biological activities, including potential antioxidant and anti-inflammatory properties. Dihydropiceatannol may also exhibit interactions with various biological targets, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and temperature. As with many organic compounds, safety considerations are important, and handling should be done with appropriate precautions to avoid exposure. Further research is often necessary to fully understand its properties and potential uses in various fields, including pharmaceuticals, cosmetics, and natural product chemistry.

Formula: C₁₄H₁₄O₄

InChI: InChI=1S/C14H14O4/c15-11-5-10(6-12(16)8-11)2-1-9-3-4-13(17)14(18)7-9/h3-8,15-18H,1-2H2

InChI key: InChIKey=KTLRRKBJXAJHJD-UHFFFAOYSA-N

SMILES: C(CC1=CC(O)=CC(O)=C1)C2=CC(O)=C(O)C=C2

Synonyms:

• 1,2-Benzenediol, 4-[2-(3,5-dihydroxyphenyl)ethyl]-
• Piceatannol, dihydro-
• Bibenzyl-3,3′,4,5′-tetrol
• 4-[2-(3,5-Dihydroxyphenyl)ethyl]-1,2-benzenediol
• Pyrocatechol, 4-(3,5-dihydroxyphenethyl)-

Dihydropiceatannol

CAS: 22318-80-5

Dihydropiceatannol analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.

Formula: C₁₄H₁₄O₄

Purity: (HPLC) ≥95%

Color and Shape: Powder

Molecular weight: 246.26

Ref: 11-4976