CAS 2232-49-7: 10H-Phenothiazine-10-propanamine, 2-chloro-, 5-oxide
Description:10H-Phenothiazine-10-propanamine, 2-chloro-, 5-oxide, with the CAS number 2232-49-7, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals, particularly as an antipsychotic or antihistamine agent. The presence of the chlorine atom and the oxide functional group can influence its reactivity and biological activity. The compound may also display moderate solubility in organic solvents, while its solubility in water can vary based on pH and other conditions. Additionally, phenothiazines are known for their ability to interact with various biological targets, which can lead to diverse pharmacological effects. Safety data should be consulted for handling and exposure guidelines, as compounds in this class can have significant biological effects and potential toxicity.
Formula:C15H15ClN2OS
InChI:InChI=1S/C15H15ClN2OS/c16-11-6-7-15-13(10-11)18(9-3-8-17)12-4-1-2-5-14(12)20(15)19/h1-2,4-7,10H,3,8-9,17H2
InChI key:InChIKey=YGJLHHBXRHEYRU-UHFFFAOYSA-N
SMILES:O=S1C=2C=CC=CC2N(C3=CC(Cl)=CC=C31)CCCN
- Synonyms:
- 10H-Phenothiazine-10-propanamine, 2-chloro-, 5-oxide
- Nor2Chlorpromazine sulfoxide
- Didemethylchlorpromazine sulfoxide
- Desdimethylchlorpromazine sulphoxide
- Phenothiazine, 10-(3-aminopropyl)-2-chloro-, 5-oxide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | didemethylchlorpromazine sulfoxide REF: IN-DA00BJ9BCAS: 2232-49-7 | 95% | To inquire | Tue 15 Apr 25 |
![]() | 10-(3-Aminopropyl)-2-chloro-10H-phenothiazine 5-oxide REF: 10-F614502CAS: 2232-49-7 | 95% | To inquire | Fri 25 Apr 25 |
![]() | 10-(3-aminopropyl)-2-chloro-10H-5'-phenothiazin-5-one REF: 3D-CAA23249CAS: 2232-49-7 | Min. 95% | - - - | Discontinued product |

didemethylchlorpromazine sulfoxide
Ref: IN-DA00BJ9B
100mg | To inquire | ||
250mg | To inquire |

10-(3-Aminopropyl)-2-chloro-10H-phenothiazine 5-oxide
Ref: 10-F614502
100mg | To inquire | ||
250mg | To inquire |

10-(3-aminopropyl)-2-chloro-10H-5'-phenothiazin-5-one
Ref: 3D-CAA23249
1g | Discontinued | Request information | |
500mg | Discontinued | Request information |