CAS 22338-67-6

Grandiflorenic acid

Description:

Grandiflorenic acid, with the CAS number 22338-67-6, is a naturally occurring organic compound classified as a phenolic acid. It is primarily derived from various plant sources, particularly those belonging to the family of flowering plants. This compound is characterized by its aromatic structure, which includes a hydroxyl group (-OH) attached to a benzene ring, contributing to its chemical reactivity and potential biological activity. Grandiflorenic acid exhibits antioxidant properties, which may play a role in protecting cells from oxidative stress. Additionally, it has been studied for its potential anti-inflammatory and antimicrobial effects, making it of interest in both pharmacological and nutritional research. The compound is typically soluble in organic solvents and may have limited solubility in water, which is common for many phenolic compounds. Its presence in various plant extracts highlights its significance in traditional medicine and natural product chemistry. Further research is ongoing to explore its full range of biological activities and potential applications in health and wellness.

Formula: C₂₀H₂₈O₂

InChI: InChI=1S/C20H28O2/c1-13-11-20-10-7-15-18(2,16(20)6-5-14(13)12-20)8-4-9-19(15,3)17(21)22/h6,14-15H,1,4-5,7-12H2,2-3H3,(H,21,22)/t14-,15+,18-,19-,20-/m1/s1

InChI key: InChIKey=RJIPNPHMQGDUBW-RFGKEDTNSA-N

SMILES: C[C@]12C=3[C@]4(C[C@@](CC3)(C(=C)C4)[H])CC[C@@]1([C@@](C(O)=O)(C)CCC2)[H]

Synonyms:

• Kaura-9(11),16-dien-18-oic acid, (4α)-
• (4α)-Kaura-9(11),16-dien-18-oic acid
• Kaura-9(11),16-dien-18-oic acid
• (-)-Kaur-9(11),16-dien-19-oic acid
• Grandiflorenic acid

Grandiflorenic acid

CAS: 22338-67-6

Formula: C₂₀H₂₈O₂

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 300.4351

Ref: IN-DA00C4S1

Grandiflorenic acid

CAS: 22338-67-6

Formula: C₂₀H₂₈O₂

Purity: 95%~99%

Molecular weight: 300.442

Ref: BP-SBP02318

Grandiflorenic acid

CAS: 22338-67-6

Grandiflorenic acid is a diterpenoid compound, which is a secondary metabolite sourced primarily from the resin of the Copaifera genus, particularly copaiba oil. This compound exhibits significant bioactivity due to its unique chemical structure, which is characterized by a bicyclic diterpene framework. The mode of action of grandiflorenic acid is largely attributed to its interaction with specific molecular pathways involved in inflammation and immune responses, which has been demonstrated in various in vitro and in vivo studies.

Formula: C₂₀H₂₈O₂

Purity: Min. 95%

Molecular weight: 300.4 g/mol

Ref: 3D-XAA33867

Grandiflorenic acid

CAS: 22338-67-6

Grandiflorenic acid mimics zoapatle-induced uterine reactions, potentially causing antifertility effects.

Formula: C₂₀H₂₈O₂

Color and Shape: Solid

Molecular weight: 300.44

Ref: TM-T20217