CAS 2234-09-5
:10-methyl-10H-phenothiazine 5-oxide
Description:
10-Methyl-10H-phenothiazine 5-oxide, with the CAS number 2234-09-5, is a chemical compound that belongs to the phenothiazine class, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms. This compound features a methyl group at the 10 position and an oxide functional group at the 5 position, which contributes to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and specific formulation. The presence of the oxide group can influence its reactivity, making it a potential candidate for various chemical reactions, including oxidation and reduction processes. Additionally, phenothiazine derivatives are known for their applications in pharmaceuticals, particularly as antipsychotic agents, and in dye chemistry. The compound's solubility can vary, often being more soluble in organic solvents than in water. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C13H11NOS
InChI:InChI=1/C13H11NOS/c1-14-10-6-2-4-8-12(10)16(15)13-9-5-3-7-11(13)14/h2-9H,1H3
Synonyms:- 10H-Phenothiazine, 10-methyl-, 5-oxide
- Phenothiazine, 10-methyl-, 5-oxide
- 10-Methylphenothiazine 5-oxide
- N-Methylphenothiazine S-oxide
- 10-Methyl-10H -phenothiazine sulfoxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methylphenothiazine Sulfoxide (10-Methyl-10H-phenothiazine Sulfoxide)
CAS:<p>Compounds (excluding drugs) containing a phenothiazine ring-system (whether or not hydrogenated), not further fused</p>Formula:C13H11NOSColor and Shape:White PowderMolecular weight:229.3 g/mol10H-Phenothiazine, 10-methyl-, 5-oxide
CAS:Formula:C13H11NOSPurity:95%Color and Shape:SolidMolecular weight:229.297510-Methyl-10H-phenothiazine 5-oxide
CAS:10-Methyl-10H-phenothiazine 5-oxidePurity:95%Molecular weight:229.3g/molMethylphenothiazine Sulfoxide
CAS:Controlled ProductFormula:C13H11NOSColor and Shape:NeatMolecular weight:229.298






