CAS 2234-97-1
:Tripropylphosphine
Description:
Tripropylphosphine is an organophosphorus compound characterized by its three propyl groups attached to a phosphorus atom. It is a colorless to pale yellow liquid at room temperature, exhibiting a distinctive odor. This compound is known for its role as a ligand in coordination chemistry, where it can stabilize metal complexes due to its ability to donate electron pairs from the phosphorus atom. Tripropylphosphine is soluble in organic solvents, making it useful in various chemical reactions, including catalysis and organic synthesis. Its reactivity is influenced by the presence of the phosphorus atom, which can participate in nucleophilic reactions. Additionally, tripropylphosphine can be used in the preparation of phosphine oxides and other derivatives. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as it may pose health risks if inhaled or ingested. Overall, tripropylphosphine is a valuable compound in both academic and industrial chemistry settings.
Formula:C9H21P
InChI:InChI=1S/C9H21P/c1-4-7-10(8-5-2)9-6-3/h4-9H2,1-3H3
InChI key:InChIKey=KCTAHLRCZMOTKM-UHFFFAOYSA-N
SMILES:P(CCC)(CCC)CCC
Synonyms:- Phosphine, tripropyl-
- Tri-n-propylphosphine
- Tripropylphosphane
- Tripropylphosphine
- Tripropylphosphinemincolorlessliq
- Cytop 330
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tri-n-propylphosphine, min. 95%
CAS:<p>Tri-n-propylphosphine, min. 95%</p>Formula:(nC3H7)3PPurity:min. 95%Color and Shape:colorless liq.Molecular weight:160.24Tripropylphosphine, min. 98%, CYTOP® 330
CAS:Formula:C9H21PPurity:min. 98%Color and Shape:Colorless liq.Molecular weight:160.24Tripropylphosphine
CAS:<p>Tripropylphosphine is a fatty acid that can be synthesized by reacting tripropyl alcohol with phosphorus trichloride. Tripropylphosphine is soluble in organic solvents, and has an optical rotation of +58°. It has been shown to have cancer-inhibiting properties, as well as the ability to inhibit tumor growth and induce apoptosis in cancer cells. This compound may also be used as a growth regulator, since it inhibits the synthesis of certain proteins and enzymes.</p>Formula:C9H21PPurity:Min. 95%Molecular weight:160.24 g/mol
