CAS 223419-20-3
:2,3,5,6-tetrafluoro-4-methylbenzyl 2,2-dimethyl-3-[(1Z)-prop-1-en-1-yl]cyclopropanecarboxylate
Description:
2,3,5,6-Tetrafluoro-4-methylbenzyl 2,2-dimethyl-3-[(1Z)-prop-1-en-1-yl]cyclopropanecarboxylate, identified by its CAS number 223419-20-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a cyclopropane ring and multiple fluorine substituents. The presence of four fluorine atoms contributes to its unique chemical properties, such as increased lipophilicity and potential stability against metabolic degradation. The methyl and prop-1-en-1-yl groups enhance its reactivity and may influence its biological activity. This compound is likely to exhibit interesting interactions in various chemical environments, making it of interest in fields such as medicinal chemistry and materials science. Its specific applications may vary, but compounds with similar structures are often explored for their potential as pharmaceuticals or agrochemicals. As with many fluorinated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application.
Formula:C17H18F4O2
InChI:InChI=1/C17H18F4O2/c1-5-6-10-11(17(10,3)4)16(22)23-7-9-14(20)12(18)8(2)13(19)15(9)21/h5-6,10-11H,7H2,1-4H3/b6-5-
SMILES:C/C=C\C1C(C(=O)OCc2c(c(c(C)c(c2F)F)F)F)C1(C)C
Synonyms:- 223419-20-3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Profluthrin
CAS:Controlled Product<p>Applications Profluthrin is a pyrethroid based insecticide. Profluthrin is an active ingredient found in moth proofer.<br>References Ujihara, K., et al.: Sumit. Kag., 2, 13 (2010);<br></p>Formula:C17H18F4O2Color and Shape:NeatMolecular weight:330.32Profluthrin
CAS:Profluthrin is a potent analog of the Chinese medicinal herb, Chrysanthemum indicum. It acts as an inhibitor of protein kinases involved in the regulation of cell cycle and apoptosis. Profluthrin has been shown to have anticancer properties by inducing apoptosis in cancer cells and inhibiting tumor growth. This compound also shows potential as a urinary inhibitor for the prevention of urinary tract infections. Its unique chemical structure allows it to act selectively on specific protein kinases, making it a promising candidate for targeted cancer therapy.Formula:C17H18F4O2Purity:Min. 95%Molecular weight:330.32 g/mol


