CAS 223432-26-6

tributyl(5-fluoro-2-methoxyphenyl)stannane

Description:

Tributyl(5-fluoro-2-methoxyphenyl)stannane is an organotin compound characterized by the presence of a tin atom bonded to three butyl groups and one 5-fluoro-2-methoxyphenyl group. This compound typically exhibits a high degree of lipophilicity due to the butyl groups, which can enhance its solubility in organic solvents. The presence of the fluorine and methoxy substituents on the phenyl ring can influence its reactivity and biological activity, potentially making it useful in various applications, including organic synthesis and materials science. Organotin compounds are known for their applications in catalysis and as intermediates in the synthesis of other chemical entities. However, they can also pose environmental and health risks due to their toxicity and bioaccumulation potential. As with many organotin compounds, proper handling and disposal are essential to mitigate any adverse effects. Overall, tributyl(5-fluoro-2-methoxyphenyl)stannane represents a unique structure within the organotin family, with specific properties dictated by its molecular composition.

Formula: C₁₉H₃₃FOSn

InChI: InChI=1/C7H6FO.3C4H9.Sn/c1-9-7-4-2-6(8)3-5-7;3*1-3-4-2;/h2-4H,1H3;3*1,3-4H2,2H3;/rC19H33FOSn/c1-5-8-13-22(14-9-6-2,15-10-7-3)19-16-17(20)11-12-18(19)21-4/h11-12,16H,5-10,13-15H2,1-4H3

SMILES: CCCC[Sn](CCCC)(CCCC)c1cc(ccc1OC)F

tributyl(5-fluoro-2-methoxyphenyl)stannane

CAS: 223432-26-6

tributyl(5-fluoro-2-methoxyphenyl)stannane

Purity: ≥95%

Molecular weight: 415.17g/mol

Ref: 54-PC32553

Tributyl(5-Fluoro-2-Methoxyphenyl)Stannane

Controlled Product

CAS: 223432-26-6

Please enquire for more information about Tributyl(5-Fluoro-2-Methoxyphenyl)Stannane including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₉H₃₃FOSn

Purity: Min. 95%

Molecular weight: 415.17 g/mol

Ref: 3D-FT87169